C27H30N6O3 — CID 46894310
1,3,5-tris[4-(dimethylamino)phenyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 46894310) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is 1,3,5-tris[4-(dimethylamino)phenyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[4-(dimethylamino)phenyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 46894310 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 1,3,5-tris[4-(dimethylamino)phenyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CN(C)c1ccc(-n2c(=O)n(-c3ccc(N(C)C)cc3)c(=O)n(-c3ccc(N(C)C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C27H30N6O3/c1-28(2)19-7-13-22(14-8-19)31-25(34)32(23-15-9-20(10-16-23)29(3)4)27(36)33(26(31)35)24-17-11-21(12-18-24)30(5)6/h7-18H,1-6H3 |
| InChIKey | UOACJYINXOMXSI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|