About (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione
(E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione (PubChem CID 46894314) has the molecular formula C23H36O5SSi
and a molecular weight of 452.69 g/mol. Its IUPAC name is (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione.
Molecular Properties
| Compound Name | (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione |
| PubChem CID | 46894314 |
| Molecular Formula | C23H36O5SSi |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione |
| SMILES | CC(=O)/C=C/CCCC(=O)C(CCO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H36O5SSi/c1-19(24)13-9-7-12-16-21(25)22(17-18-28-30(5,6)23(2,3)4)29(26,27)20-14-10-8-11-15-20/h8-11,13-15,22H,7,12,16-18H2,1-6H3/b13-9+ |
| InChIKey | RAZBAPQWJHLXRG-UKTHLTGXSA-N |
| XLogP | 5.13 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione?
The IUPAC name of (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione (CID 46894314) is (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione.
What is the SMILES notation for (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione?
The canonical SMILES for (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione is CC(=O)/C=C/CCCC(=O)C(CCO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1.
What is the InChIKey of (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione?
The InChIKey is RAZBAPQWJHLXRG-UKTHLTGXSA-N. The full InChI is InChI=1S/C23H36O5SSi/c1-19(24)13-9-7-12-16-21(25)22(17-18-28-30(5,6)23(2,3)4)29(26,27)20-14-10-8-11-15-20/h8-11,13-15,22H,7,12,16-18H2,1-6H3/b13-9+.
What are the key properties of (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione?
(E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione has a molecular weight of 452.69 g/mol, XLogP of 5.13, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-9-(benzenesulfonyl)-11-[tert-butyl(dimethyl)silyl]oxyundec-3-ene-2,8-dione is sourced from PubChem (CID 46894314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).