C30H62O6Si2 — CID 46894696
tert-butyl-[(E,2R)-7-[(2S,5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-yl]hept-6-en-2-yl]oxy-dimethylsilane (PubChem CID 46894696) has the molecular formula C30H62O6Si2 and a molecular weight of 574.99 g/mol. Its IUPAC name is tert-butyl-[(E,2R)-7-[(2S,5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-yl]hept-6-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R)-7-[(2S,5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-yl]hept-6-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 46894696 |
| Molecular Formula | C30H62O6Si2 |
| Molecular Weight | 574.99 g/mol |
| Exact Mass | 574.41 |
| IUPAC Name | tert-butyl-[(E,2R)-7-[(2S,5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-yl]hept-6-en-2-yl]oxy-dimethylsilane |
| SMILES | COCCOCO[C@@H]1CC[C@@H](/C=C/CCC[C@@H](C)O[Si](C)(C)C(C)(C)C)O[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H62O6Si2/c1-25(36-38(11,12)30(5,6)7)16-14-13-15-17-26-18-19-27(33-24-32-23-22-31-8)28(35-26)20-21-34-37(9,10)29(2,3)4/h15,17,25-28H,13-14,16,18-24H2,1-12H3/b17-15+/t25-,26-,27-,28-/m1/s1 |
| InChIKey | IITZDHVOHBLTBZ-ACVZNPHXSA-N |
| XLogP | 8.09 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.99 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|