About 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione
6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione (PubChem CID 46894801) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione |
| PubChem CID | 46894801 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(Cc1cc(=O)[nH]c(=O)[nH]1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H20N2O3/c19-13(4-12-5-14(20)18-15(21)17-12)16-6-9-1-10(7-16)3-11(2-9)8-16/h5,9-11H,1-4,6-8H2,(H2,17,18,20,21) |
| InChIKey | VZVBHUWTYTWMJX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione (CID 46894801) is 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione is O=C(Cc1cc(=O)[nH]c(=O)[nH]1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione?
The InChIKey is VZVBHUWTYTWMJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c19-13(4-12-5-14(20)18-15(21)17-12)16-6-9-1-10(7-16)3-11(2-9)8-16/h5,9-11H,1-4,6-8H2,(H2,17,18,20,21).
What are the key properties of 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione?
6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione has a molecular weight of 288.35 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(1-adamantyl)-2-oxoethyl]-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 46894801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).