C18H32O7 — CID 46894826
2-[(2R,3R,6S)-6-[(E,6R)-6-hydroxyhept-1-enyl]-3-(2-methoxyethoxymethoxy)oxan-2-yl]acetic acid (PubChem CID 46894826) has the molecular formula C18H32O7 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-[(2R,3R,6S)-6-[(E,6R)-6-hydroxyhept-1-enyl]-3-(2-methoxyethoxymethoxy)oxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3R,6S)-6-[(E,6R)-6-hydroxyhept-1-enyl]-3-(2-methoxyethoxymethoxy)oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 46894826 |
| Molecular Formula | C18H32O7 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-[(2R,3R,6S)-6-[(E,6R)-6-hydroxyhept-1-enyl]-3-(2-methoxyethoxymethoxy)oxan-2-yl]acetic acid |
| SMILES | COCCOCO[C@@H]1CC[C@@H](/C=C/CCC[C@@H](C)O)O[C@@H]1CC(=O)O |
| InChI | InChI=1S/C18H32O7/c1-14(19)6-4-3-5-7-15-8-9-16(17(25-15)12-18(20)21)24-13-23-11-10-22-2/h5,7,14-17,19H,3-4,6,8-13H2,1-2H3,(H,20,21)/b7-5+/t14-,15-,16-,17-/m1/s1 |
| InChIKey | ZVTFPGRERMSSJT-YOBDDAPSSA-N |
| XLogP | 2.12 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|