C15H28O4Si — CID 46894837
2-[(2R,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethenyloxan-2-yl]acetic acid (PubChem CID 46894837) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is 2-[(2R,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethenyloxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethenyloxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 46894837 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[(2R,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethenyloxan-2-yl]acetic acid |
| SMILES | C=C[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CC(=O)O)O1 |
| InChI | InChI=1S/C15H28O4Si/c1-7-11-8-9-12(13(18-11)10-14(16)17)19-20(5,6)15(2,3)4/h7,11-13H,1,8-10H2,2-6H3,(H,16,17)/t11-,12-,13+/m0/s1 |
| InChIKey | SHWGNOHVOIBZEN-RWMBFGLXSA-N |
| XLogP | 3.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|