C20H38O2Si — CID 46894988
tert-butyl-[[(1R,3R,4S,7R)-1,3-dimethyl-3-(4-methylpent-3-enyl)-2-oxabicyclo[2.2.1]heptan-7-yl]oxy]-dimethylsilane (PubChem CID 46894988) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is tert-butyl-[[(1R,3R,4S,7R)-1,3-dimethyl-3-(4-methylpent-3-enyl)-2-oxabicyclo[2.2.1]heptan-7-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,3R,4S,7R)-1,3-dimethyl-3-(4-methylpent-3-enyl)-2-oxabicyclo[2.2.1]heptan-7-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 46894988 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | tert-butyl-[[(1R,3R,4S,7R)-1,3-dimethyl-3-(4-methylpent-3-enyl)-2-oxabicyclo[2.2.1]heptan-7-yl]oxy]-dimethylsilane |
| SMILES | CC(C)=CCC[C@@]1(C)O[C@]2(C)CC[C@H]1[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O2Si/c1-15(2)11-10-13-19(6)16-12-14-20(7,22-19)17(16)21-23(8,9)18(3,4)5/h11,16-17H,10,12-14H2,1-9H3/t16-,17+,19+,20+/m0/s1 |
| InChIKey | FUCXJZMSCAWKFJ-ONCXSQPRSA-N |
| XLogP | 6.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|