About triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane
triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane (PubChem CID 46895365) has the molecular formula C19H36OSi
and a molecular weight of 308.58 g/mol. Its IUPAC name is triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane |
| PubChem CID | 46895365 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane |
| SMILES | C/C=C(\C)C(=C=CCCCCCC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H36OSi/c1-7-12-13-14-15-16-17-19(18(6)8-2)20-21(9-3,10-4)11-5/h8,16H,7,9-15H2,1-6H3/b18-8+ |
| InChIKey | PGZKNIMCXAIVRQ-QGMBQPNBSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane?
The IUPAC name of triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane (CID 46895365) is triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane.
What is the SMILES notation for triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane?
The canonical SMILES for triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane is C/C=C(\C)C(=C=CCCCCCC)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane?
The InChIKey is PGZKNIMCXAIVRQ-QGMBQPNBSA-N. The full InChI is InChI=1S/C19H36OSi/c1-7-12-13-14-15-16-17-19(18(6)8-2)20-21(9-3,10-4)11-5/h8,16H,7,9-15H2,1-6H3/b18-8+.
What are the key properties of triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane?
triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane has a molecular weight of 308.58 g/mol, XLogP of 6.98, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(2E)-3-methyldodeca-2,4,5-trien-4-yl]oxysilane is sourced from PubChem (CID 46895365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).