C24H48O4Si — CID 46895516
(2S,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5R,6S)-6-ethyl-2,2,5-trimethyl-1,3-dioxan-4-yl]-2,4-dimethylheptanal (PubChem CID 46895516) has the molecular formula C24H48O4Si and a molecular weight of 428.73 g/mol. Its IUPAC name is (2S,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5R,6S)-6-ethyl-2,2,5-trimethyl-1,3-dioxan-4-yl]-2,4-dimethylheptanal.
| Compound Name | (2S,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5R,6S)-6-ethyl-2,2,5-trimethyl-1,3-dioxan-4-yl]-2,4-dimethylheptanal |
|---|---|
| PubChem CID | 46895516 |
| Molecular Formula | C24H48O4Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (2S,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5R,6S)-6-ethyl-2,2,5-trimethyl-1,3-dioxan-4-yl]-2,4-dimethylheptanal |
| SMILES | CC[C@@H]1OC(C)(C)O[C@@H]([C@H](C)C[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=O)[C@@H]1C |
| InChI | InChI=1S/C24H48O4Si/c1-13-20-19(5)22(27-24(9,10)26-20)17(3)14-16(2)21(18(4)15-25)28-29(11,12)23(6,7)8/h15-22H,13-14H2,1-12H3/t16-,17-,18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | UZKGHSZXYXAEOE-CBDMQDTOSA-N |
| XLogP | 6.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|