C37H82O5Si4 — CID 46895956
(3S,5S,6S,7R,8S,9S)-3,6,8,10-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyldecan-2-one (PubChem CID 46895956) has the molecular formula C37H82O5Si4 and a molecular weight of 719.40 g/mol. Its IUPAC name is (3S,5S,6S,7R,8S,9S)-3,6,8,10-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyldecan-2-one.
| Compound Name | (3S,5S,6S,7R,8S,9S)-3,6,8,10-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyldecan-2-one |
|---|---|
| PubChem CID | 46895956 |
| Molecular Formula | C37H82O5Si4 |
| Molecular Weight | 719.40 g/mol |
| Exact Mass | 718.52 |
| IUPAC Name | (3S,5S,6S,7R,8S,9S)-3,6,8,10-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyldecan-2-one |
| SMILES | CC(=O)[C@H](C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H82O5Si4/c1-27(25-31(30(4)38)40-44(19,20)35(8,9)10)32(41-45(21,22)36(11,12)13)29(3)33(42-46(23,24)37(14,15)16)28(2)26-39-43(17,18)34(5,6)7/h27-29,31-33H,25-26H2,1-24H3/t27-,28-,29+,31-,32-,33-/m0/s1 |
| InChIKey | SYNNVVDGJLBOLN-MUIHSLIFSA-N |
| XLogP | 12.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.40 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|