About tris(4-bromo-2,6-dimethylphenyl)borane
tris(4-bromo-2,6-dimethylphenyl)borane (PubChem CID 46896100) has the molecular formula C24H24BBr3
and a molecular weight of 562.98 g/mol. Its IUPAC name is tris(4-bromo-2,6-dimethylphenyl)borane.
Molecular Properties
| Compound Name | tris(4-bromo-2,6-dimethylphenyl)borane |
| PubChem CID | 46896100 |
| Molecular Formula | C24H24BBr3 |
| Molecular Weight | 562.98 g/mol |
| Exact Mass | 559.95 |
| IUPAC Name | tris(4-bromo-2,6-dimethylphenyl)borane |
| SMILES | Cc1cc(Br)cc(C)c1B(c1c(C)cc(Br)cc1C)c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C24H24BBr3/c1-13-7-19(26)8-14(2)22(13)25(23-15(3)9-20(27)10-16(23)4)24-17(5)11-21(28)12-18(24)6/h7-12H,1-6H3 |
| InChIKey | VOEYAZBVWMOXNF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.98 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(4-bromo-2,6-dimethylphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(4-bromo-2,6-dimethylphenyl)borane?
The IUPAC name of tris(4-bromo-2,6-dimethylphenyl)borane (CID 46896100) is tris(4-bromo-2,6-dimethylphenyl)borane.
What is the SMILES notation for tris(4-bromo-2,6-dimethylphenyl)borane?
The canonical SMILES for tris(4-bromo-2,6-dimethylphenyl)borane is Cc1cc(Br)cc(C)c1B(c1c(C)cc(Br)cc1C)c1c(C)cc(Br)cc1C.
What is the InChIKey of tris(4-bromo-2,6-dimethylphenyl)borane?
The InChIKey is VOEYAZBVWMOXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24BBr3/c1-13-7-19(26)8-14(2)22(13)25(23-15(3)9-20(27)10-16(23)4)24-17(5)11-21(28)12-18(24)6/h7-12H,1-6H3.
What are the key properties of tris(4-bromo-2,6-dimethylphenyl)borane?
tris(4-bromo-2,6-dimethylphenyl)borane has a molecular weight of 562.98 g/mol, XLogP of 6.34, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(4-bromo-2,6-dimethylphenyl)borane is sourced from PubChem (CID 46896100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).