C19H17N5O5S — CID 46896538
2-(4-methoxyanilino)-5-[(3-methyl-4-nitrobenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 46896538) has the molecular formula C19H17N5O5S and a molecular weight of 427.44 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-5-[(3-methyl-4-nitrobenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-methoxyanilino)-5-[(3-methyl-4-nitrobenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46896538 |
| Molecular Formula | C19H17N5O5S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-(4-methoxyanilino)-5-[(3-methyl-4-nitrobenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(Nc2nc(C(N)=O)c(NC(=O)c3ccc([N+](=O)[O-])c(C)c3)s2)cc1 |
| InChI | InChI=1S/C19H17N5O5S/c1-10-9-11(3-8-14(10)24(27)28)17(26)23-18-15(16(20)25)22-19(30-18)21-12-4-6-13(29-2)7-5-12/h3-9H,1-2H3,(H2,20,25)(H,21,22)(H,23,26) |
| InChIKey | KNEOWHLVEZHNTL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|