C25H31BrClN3O2 — CID 46897085
6-bromo-1-(5-chloropentyl)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-[1]benzofuro[3,2-c]pyrazole-3-carboxamide (PubChem CID 46897085) has the molecular formula C25H31BrClN3O2 and a molecular weight of 520.90 g/mol. Its IUPAC name is 6-bromo-1-(5-chloropentyl)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-[1]benzofuro[3,2-c]pyrazole-3-carboxamide.
| Compound Name | 6-bromo-1-(5-chloropentyl)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-[1]benzofuro[3,2-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46897085 |
| Molecular Formula | C25H31BrClN3O2 |
| Molecular Weight | 520.90 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 6-bromo-1-(5-chloropentyl)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-[1]benzofuro[3,2-c]pyrazole-3-carboxamide |
| SMILES | CC1(C)C2CCC(CNC(=O)c3nn(CCCCCCl)c4c3oc3cc(Br)ccc34)C1C2 |
| InChI | InChI=1S/C25H31BrClN3O2/c1-25(2)16-7-6-15(19(25)12-16)14-28-24(31)21-23-22(30(29-21)11-5-3-4-10-27)18-9-8-17(26)13-20(18)32-23/h8-9,13,15-16,19H,3-7,10-12,14H2,1-2H3,(H,28,31) |
| InChIKey | VSFLYNUPDHNHMV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.90 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|