C19H16BFN2O3S — CID 46897162
[2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]sulfanylmethyl]phenyl]boronic acid (PubChem CID 46897162) has the molecular formula C19H16BFN2O3S and a molecular weight of 382.23 g/mol. Its IUPAC name is [2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]sulfanylmethyl]phenyl]boronic acid.
| Compound Name | [2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]sulfanylmethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 46897162 |
| Molecular Formula | C19H16BFN2O3S |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]sulfanylmethyl]phenyl]boronic acid |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc(SCc2ccccc2B(O)O)nc1 |
| InChI | InChI=1S/C19H16BFN2O3S/c21-15-6-8-16(9-7-15)23-19(24)13-5-10-18(22-11-13)27-12-14-3-1-2-4-17(14)20(25)26/h1-11,25-26H,12H2,(H,23,24) |
| InChIKey | VZRIHFZJVIOJBE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|