C27H32ClN3O4 — CID 46897238
N-[1-(3-chlorophenyl)butyl]-2-[1-[4-(hydroxymethyl)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 46897238) has the molecular formula C27H32ClN3O4 and a molecular weight of 498.02 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)butyl]-2-[1-[4-(hydroxymethyl)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[1-(3-chlorophenyl)butyl]-2-[1-[4-(hydroxymethyl)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 46897238 |
| Molecular Formula | C27H32ClN3O4 |
| Molecular Weight | 498.02 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[1-(3-chlorophenyl)butyl]-2-[1-[4-(hydroxymethyl)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCCC(NC(=O)CN1C(=O)N(c2ccc(CO)cc2)C2(CCCCC2)C1=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H32ClN3O4/c1-2-7-23(20-8-6-9-21(28)16-20)29-24(33)17-30-25(34)27(14-4-3-5-15-27)31(26(30)35)22-12-10-19(18-32)11-13-22/h6,8-13,16,23,32H,2-5,7,14-15,17-18H2,1H3,(H,29,33) |
| InChIKey | QSHVMLMENAHSFJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.02 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|