C22H10Cl4I2O5 — CID 46898230
2,3,4,5-tetrachloro-6-(3-hydroxy-2,7-diiodo-4,5-dimethyl-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 46898230) has the molecular formula C22H10Cl4I2O5 and a molecular weight of 749.94 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-(3-hydroxy-2,7-diiodo-4,5-dimethyl-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-(3-hydroxy-2,7-diiodo-4,5-dimethyl-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 46898230 |
| Molecular Formula | C22H10Cl4I2O5 |
| Molecular Weight | 749.94 g/mol |
| Exact Mass | 747.74 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-(3-hydroxy-2,7-diiodo-4,5-dimethyl-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Cc1c2oc3c(C)c(O)c(I)cc3c(-c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)c-2cc(I)c1=O |
| InChI | InChI=1S/C22H10Cl4I2O5/c1-5-18(29)9(27)3-7-11(8-4-10(28)19(30)6(2)21(8)33-20(5)7)12-13(22(31)32)15(24)17(26)16(25)14(12)23/h3-4,29H,1-2H3,(H,31,32) |
| InChIKey | ORSZHHBUUJYDLP-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.94 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|