C25H25N3O5 — CID 46898249
N-(2-amino-2-methylpropyl)-16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide (PubChem CID 46898249) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide.
| Compound Name | N-(2-amino-2-methylpropyl)-16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide |
|---|---|
| PubChem CID | 46898249 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide |
| SMILES | COc1cc2c(C(=O)NCC(C)(C)N)cc3c4cc5c(cc4ncc3c2cc1OC)OCO5 |
| InChI | InChI=1S/C25H25N3O5/c1-25(2,26)11-28-24(29)17-5-13-16-8-22-23(33-12-32-22)9-19(16)27-10-18(13)15-7-21(31-4)20(30-3)6-14(15)17/h5-10H,11-12,26H2,1-4H3,(H,28,29) |
| InChIKey | APROWQQCHPNZBN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|