C29H33N3O5 — CID 46898316
N-[4-(dimethylamino)-4-methylpentyl]-16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide (PubChem CID 46898316) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[4-(dimethylamino)-4-methylpentyl]-16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide.
| Compound Name | N-[4-(dimethylamino)-4-methylpentyl]-16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide |
|---|---|
| PubChem CID | 46898316 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-[4-(dimethylamino)-4-methylpentyl]-16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxamide |
| SMILES | COc1cc2c(C(=O)NCCCC(C)(C)N(C)C)cc3c4cc5c(cc4ncc3c2cc1OC)OCO5 |
| InChI | InChI=1S/C29H33N3O5/c1-29(2,32(3)4)8-7-9-30-28(33)21-10-17-20-13-26-27(37-16-36-26)14-23(20)31-15-22(17)19-12-25(35-6)24(34-5)11-18(19)21/h10-15H,7-9,16H2,1-6H3,(H,30,33) |
| InChIKey | LIQXXKXJTNUGPQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|