C24H24N4O3 — CID 46898537
6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[1-(3-nitrophenyl)piperidin-4-yl]methanone (PubChem CID 46898537) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[1-(3-nitrophenyl)piperidin-4-yl]methanone.
| Compound Name | 6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[1-(3-nitrophenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 46898537 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[1-(3-nitrophenyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2cccc([N+](=O)[O-])c2)CC1)N1Cc2cccn2Cc2ccccc21 |
| InChI | InChI=1S/C24H24N4O3/c29-24(18-10-13-25(14-11-18)20-6-3-7-21(15-20)28(30)31)27-17-22-8-4-12-26(22)16-19-5-1-2-9-23(19)27/h1-9,12,15,18H,10-11,13-14,16-17H2 |
| InChIKey | QUCABIDSCKVINF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|