C24H21N5O2S — CID 46899194
1,5-dibenzyl-2,2-dioxo-6-phenylimidazo[4,5-c][1,2,6]thiadiazin-4-amine (PubChem CID 46899194) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is 1,5-dibenzyl-2,2-dioxo-6-phenylimidazo[4,5-c][1,2,6]thiadiazin-4-amine.
| Compound Name | 1,5-dibenzyl-2,2-dioxo-6-phenylimidazo[4,5-c][1,2,6]thiadiazin-4-amine |
|---|---|
| PubChem CID | 46899194 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1,5-dibenzyl-2,2-dioxo-6-phenylimidazo[4,5-c][1,2,6]thiadiazin-4-amine |
| SMILES | NC1=NS(=O)(=O)N(Cc2ccccc2)c2nc(-c3ccccc3)n(Cc3ccccc3)c21 |
| InChI | InChI=1S/C24H21N5O2S/c25-22-21-24(29(32(30,31)27-22)17-19-12-6-2-7-13-19)26-23(20-14-8-3-9-15-20)28(21)16-18-10-4-1-5-11-18/h1-15H,16-17H2,(H2,25,27) |
| InChIKey | UKLLCDRXZJNDSI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |