C11H18F6N4O2 — CID 46899573
2,2,2-trifluoro-N-[2-[3-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]propylamino]ethyl]acetamide (PubChem CID 46899573) has the molecular formula C11H18F6N4O2 and a molecular weight of 352.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[3-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]propylamino]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[3-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]propylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 46899573 |
| Molecular Formula | C11H18F6N4O2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[3-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]propylamino]ethyl]acetamide |
| SMILES | O=C(NCCNCCCNCCNC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H18F6N4O2/c12-10(13,14)8(22)20-6-4-18-2-1-3-19-5-7-21-9(23)11(15,16)17/h18-19H,1-7H2,(H,20,22)(H,21,23) |
| InChIKey | OOCHSWKGVKRYIA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|