C32H51NO7Si2 — CID 46899658
methyl (2S,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-7-[methoxy(methyl)amino]-7-oxoheptanoate (PubChem CID 46899658) has the molecular formula C32H51NO7Si2 and a molecular weight of 617.93 g/mol. Its IUPAC name is methyl (2S,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-7-[methoxy(methyl)amino]-7-oxoheptanoate.
| Compound Name | methyl (2S,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-7-[methoxy(methyl)amino]-7-oxoheptanoate |
|---|---|
| PubChem CID | 46899658 |
| Molecular Formula | C32H51NO7Si2 |
| Molecular Weight | 617.93 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | methyl (2S,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-7-[methoxy(methyl)amino]-7-oxoheptanoate |
| SMILES | COC(=O)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)C[C@@H](CC(=O)N(C)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H51NO7Si2/c1-31(2,3)41(10,11)39-24(23-28(35)33(7)38-9)22-27(34)29(30(36)37-8)40-42(32(4,5)6,25-18-14-12-15-19-25)26-20-16-13-17-21-26/h12-21,24,27,29,34H,22-23H2,1-11H3/t24-,27+,29-/m0/s1 |
| InChIKey | FVUCRWRVWPLFHJ-HWUUJZMBSA-N |
| XLogP | 4.66 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.93 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|