C20H27F3O8S — CID 46899777
[(6aR,9S,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl] trifluoromethanesulfonate (PubChem CID 46899777) has the molecular formula C20H27F3O8S and a molecular weight of 484.49 g/mol. Its IUPAC name is [(6aR,9S,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl] trifluoromethanesulfonate.
| Compound Name | [(6aR,9S,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 46899777 |
| Molecular Formula | C20H27F3O8S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [(6aR,9S,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl] trifluoromethanesulfonate |
| SMILES | COCOc1cc(OS(=O)(=O)C(F)(F)F)cc2c1[C@@H]1C[C@@H](OCOC)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C20H27F3O8S/c1-19(2)15-6-5-12(28-10-26-3)7-14(15)18-16(29-11-27-4)8-13(9-17(18)30-19)31-32(24,25)20(21,22)23/h8-9,12,14-15H,5-7,10-11H2,1-4H3/t12-,14+,15+/m0/s1 |
| InChIKey | DSUWRMMHYAZEHM-NWANDNLSSA-N |
| XLogP | 3.94 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|