C18H38O4Si — CID 46899843
(3S,4S,6S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-3,7-dimethyloct-1-en-4-ol (PubChem CID 46899843) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is (3S,4S,6S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-3,7-dimethyloct-1-en-4-ol.
| Compound Name | (3S,4S,6S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-3,7-dimethyloct-1-en-4-ol |
|---|---|
| PubChem CID | 46899843 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (3S,4S,6S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-3,7-dimethyloct-1-en-4-ol |
| SMILES | C=C[C@H](C)[C@@H](O)C[C@H](OCOC)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O4Si/c1-10-14(2)16(19)11-17(21-13-20-7)15(3)12-22-23(8,9)18(4,5)6/h10,14-17,19H,1,11-13H2,2-9H3/t14-,15+,16-,17-/m0/s1 |
| InChIKey | BAIAIYOFSYSKMN-YVSFHVDLSA-N |
| XLogP | 4.21 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|