C18H38O5Si — CID 46899844
(2R,3S,5S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(methoxymethoxy)-2,6-dimethylheptanal (PubChem CID 46899844) has the molecular formula C18H38O5Si and a molecular weight of 362.58 g/mol. Its IUPAC name is (2R,3S,5S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(methoxymethoxy)-2,6-dimethylheptanal.
| Compound Name | (2R,3S,5S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(methoxymethoxy)-2,6-dimethylheptanal |
|---|---|
| PubChem CID | 46899844 |
| Molecular Formula | C18H38O5Si |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (2R,3S,5S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(methoxymethoxy)-2,6-dimethylheptanal |
| SMILES | COCO[C@@H](C[C@H](OC)C(C)C=O)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O5Si/c1-14(11-19)16(21-7)10-17(22-13-20-6)15(2)12-23-24(8,9)18(3,4)5/h11,14-17H,10,12-13H2,1-9H3/t14?,15-,16+,17+/m1/s1 |
| InChIKey | KVLPPYIECIVYGF-HIGTXEFZSA-N |
| XLogP | 3.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|