C24H29N5O — CID 46900065
1-[3-[2-(cyclohexylamino)-4-pyridinyl]-2,6-naphthyridin-1-yl]piperidin-4-ol (PubChem CID 46900065) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is 1-[3-[2-(cyclohexylamino)-4-pyridinyl]-2,6-naphthyridin-1-yl]piperidin-4-ol.
| Compound Name | 1-[3-[2-(cyclohexylamino)-4-pyridinyl]-2,6-naphthyridin-1-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 46900065 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 1-[3-[2-(cyclohexylamino)-4-pyridinyl]-2,6-naphthyridin-1-yl]piperidin-4-ol |
| SMILES | OC1CCN(c2nc(-c3ccnc(NC4CCCCC4)c3)cc3cnccc23)CC1 |
| InChI | InChI=1S/C24H29N5O/c30-20-8-12-29(13-9-20)24-21-7-10-25-16-18(21)14-22(28-24)17-6-11-26-23(15-17)27-19-4-2-1-3-5-19/h6-7,10-11,14-16,19-20,30H,1-5,8-9,12-13H2,(H,26,27) |
| InChIKey | OUTRLMLUGPKALY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |