About (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine
(8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine (PubChem CID 46900144) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine.
Molecular Properties
| Compound Name | (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine |
| PubChem CID | 46900144 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine |
| SMILES | C=CCc1cccc2c1OCC(NN)=N2 |
| InChI | InChI=1S/C11H13N3O/c1-2-4-8-5-3-6-9-11(8)15-7-10(13-9)14-12/h2-3,5-6H,1,4,7,12H2,(H,13,14) |
| InChIKey | UIEACVLWTGQQTK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine?
The IUPAC name of (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine (CID 46900144) is (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine.
What is the SMILES notation for (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine?
The canonical SMILES for (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine is C=CCc1cccc2c1OCC(NN)=N2.
What is the InChIKey of (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine?
The InChIKey is UIEACVLWTGQQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c1-2-4-8-5-3-6-9-11(8)15-7-10(13-9)14-12/h2-3,5-6H,1,4,7,12H2,(H,13,14).
What are the key properties of (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine?
(8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine has a molecular weight of 203.25 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-prop-2-enyl-2H-1,4-benzoxazin-3-yl)hydrazine is sourced from PubChem (CID 46900144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).