C27H42O3Si — CID 46900169
(6aR,6bS,7S,9S,11aS,11bR)-9-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-10,11b-dimethyl-2,5,6,6a,6b,7,8,9,11,11a-decahydro-1H-benzo[a]fluoren-3-one (PubChem CID 46900169) has the molecular formula C27H42O3Si and a molecular weight of 442.72 g/mol. Its IUPAC name is (6aR,6bS,7S,9S,11aS,11bR)-9-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-10,11b-dimethyl-2,5,6,6a,6b,7,8,9,11,11a-decahydro-1H-benzo[a]fluoren-3-one.
| Compound Name | (6aR,6bS,7S,9S,11aS,11bR)-9-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-10,11b-dimethyl-2,5,6,6a,6b,7,8,9,11,11a-decahydro-1H-benzo[a]fluoren-3-one |
|---|---|
| PubChem CID | 46900169 |
| Molecular Formula | C27H42O3Si |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (6aR,6bS,7S,9S,11aS,11bR)-9-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-10,11b-dimethyl-2,5,6,6a,6b,7,8,9,11,11a-decahydro-1H-benzo[a]fluoren-3-one |
| SMILES | CC(=O)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C(=C1C)C[C@H]1[C@H]2CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C27H42O3Si/c1-16-21(17(2)28)15-24(30-31(7,8)26(3,4)5)25-20-10-9-18-13-19(29)11-12-27(18,6)23(20)14-22(16)25/h13,20-21,23-25H,9-12,14-15H2,1-8H3/t20-,21+,23+,24+,25+,27+/m1/s1 |
| InChIKey | GSSIVMUQHWTMNS-MZOQEMEFSA-N |
| XLogP | 6.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|