C33H21Br2N3 — CID 46900331
2-(3,5-dibromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 46900331) has the molecular formula C33H21Br2N3 and a molecular weight of 619.36 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(3,5-dibromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 46900331 |
| Molecular Formula | C33H21Br2N3 |
| Molecular Weight | 619.36 g/mol |
| Exact Mass | 617.01 |
| IUPAC Name | 2-(3,5-dibromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Brc1cc(Br)cc(-c2nc(-c3cccc(-c4ccccc4)c3)nc(-c3cccc(-c4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C33H21Br2N3/c34-29-19-28(20-30(35)21-29)33-37-31(26-15-7-13-24(17-26)22-9-3-1-4-10-22)36-32(38-33)27-16-8-14-25(18-27)23-11-5-2-6-12-23/h1-21H |
| InChIKey | UIXJXPLYOGSPMR-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.36 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |