C45H45B2N3O4 — CID 46900332
2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 46900332) has the molecular formula C45H45B2N3O4 and a molecular weight of 713.50 g/mol. Its IUPAC name is 2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 46900332 |
| Molecular Formula | C45H45B2N3O4 |
| Molecular Weight | 713.50 g/mol |
| Exact Mass | 713.36 |
| IUPAC Name | 2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cc(B3OC(C)(C)C(C)(C)O3)cc(-c3nc(-c4cccc(-c5ccccc5)c4)nc(-c4cccc(-c5ccccc5)c4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C45H45B2N3O4/c1-42(2)43(3,4)52-46(51-42)37-27-36(28-38(29-37)47-53-44(5,6)45(7,8)54-47)41-49-39(34-23-15-21-32(25-34)30-17-11-9-12-18-30)48-40(50-41)35-24-16-22-33(26-35)31-19-13-10-14-20-31/h9-29H,1-8H3 |
| InChIKey | UNVSOZSDCGRHCG-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.50 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|