C18H24F3NO3 — CID 46900471
(1S,3R,5S,7R,10S)-7-methyl-14-(2,2,2-trifluoroacetyl)-2-oxa-14-azatetracyclo[8.7.0.01,3.05,10]heptadecan-9-one (PubChem CID 46900471) has the molecular formula C18H24F3NO3 and a molecular weight of 359.39 g/mol. Its IUPAC name is (1S,3R,5S,7R,10S)-7-methyl-14-(2,2,2-trifluoroacetyl)-2-oxa-14-azatetracyclo[8.7.0.01,3.05,10]heptadecan-9-one.
| Compound Name | (1S,3R,5S,7R,10S)-7-methyl-14-(2,2,2-trifluoroacetyl)-2-oxa-14-azatetracyclo[8.7.0.01,3.05,10]heptadecan-9-one |
|---|---|
| PubChem CID | 46900471 |
| Molecular Formula | C18H24F3NO3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (1S,3R,5S,7R,10S)-7-methyl-14-(2,2,2-trifluoroacetyl)-2-oxa-14-azatetracyclo[8.7.0.01,3.05,10]heptadecan-9-one |
| SMILES | C[C@H]1CC(=O)[C@]23CCCN(C(=O)C(F)(F)F)CCC[C@]24O[C@@H]4C[C@@H]3C1 |
| InChI | InChI=1S/C18H24F3NO3/c1-11-8-12-10-14-17(25-14)5-3-7-22(15(24)18(19,20)21)6-2-4-16(12,17)13(23)9-11/h11-12,14H,2-10H2,1H3/t11-,12+,14-,16-,17-/m1/s1 |
| InChIKey | MHPKWAZNQQXFTP-ASZJLXIDSA-N |
| XLogP | 3.09 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|