About tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate
tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate (PubChem CID 46900495) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate |
| PubChem CID | 46900495 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate |
| SMILES | CN(NC1=CC(=O)CC(C)(C)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O3/c1-13(2,3)19-12(18)16(6)15-10-7-11(17)9-14(4,5)8-10/h7,15H,8-9H2,1-6H3 |
| InChIKey | IAFITCVMTVGJMO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate (CID 46900495) is tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate is CN(NC1=CC(=O)CC(C)(C)C1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate?
The InChIKey is IAFITCVMTVGJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-13(2,3)19-12(18)16(6)15-10-7-11(17)9-14(4,5)8-10/h7,15H,8-9H2,1-6H3.
What are the key properties of tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate?
tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate has a molecular weight of 268.36 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-N-methylcarbamate is sourced from PubChem (CID 46900495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).