About bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium
bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium (PubChem CID 46900632) has the molecular formula C32H56N2P2Pd
and a molecular weight of 637.18 g/mol. Its IUPAC name is bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium.
Molecular Properties
| Compound Name | bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium |
| PubChem CID | 46900632 |
| Molecular Formula | C32H56N2P2Pd |
| Molecular Weight | 637.18 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium |
| SMILES | CN(C)c1ccc(P(C(C)(C)C)C(C)(C)C)cc1.CN(C)c1ccc(P(C(C)(C)C)C(C)(C)C)cc1.[Pd] |
| InChI | InChI=1S/2C16H28NP.Pd/c2*1-15(2,3)18(16(4,5)6)14-11-9-13(10-12-14)17(7)8;/h2*9-12H,1-8H3; |
| InChIKey | SSPOQURGNAWORH-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.18 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium?
The IUPAC name of bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium (CID 46900632) is bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium.
What is the SMILES notation for bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium?
The canonical SMILES for bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium is CN(C)c1ccc(P(C(C)(C)C)C(C)(C)C)cc1.CN(C)c1ccc(P(C(C)(C)C)C(C)(C)C)cc1.[Pd].
What is the InChIKey of bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium?
The InChIKey is SSPOQURGNAWORH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H28NP.Pd/c2*1-15(2,3)18(16(4,5)6)14-11-9-13(10-12-14)17(7)8;/h2*9-12H,1-8H3;.
What are the key properties of bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium?
bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium has a molecular weight of 637.18 g/mol, XLogP of 8.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-ditert-butylphosphanyl-N,N-dimethylaniline);palladium is sourced from PubChem (CID 46900632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).