C15H28O2Si — CID 46901142
[(3E,3aS,6aR)-3-ethylidene-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl]oxy-triethylsilane (PubChem CID 46901142) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is [(3E,3aS,6aR)-3-ethylidene-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl]oxy-triethylsilane.
| Compound Name | [(3E,3aS,6aR)-3-ethylidene-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 46901142 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | [(3E,3aS,6aR)-3-ethylidene-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl]oxy-triethylsilane |
| SMILES | C/C=C1\CO[C@@H]2CCC[C@]12O[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H28O2Si/c1-5-13-12-16-14-10-9-11-15(13,14)17-18(6-2,7-3)8-4/h5,14H,6-12H2,1-4H3/b13-5+/t14-,15+/m1/s1 |
| InChIKey | MPCRYGUBUKLLCS-MZGVWUSBSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|