C21H30O4 — CID 46901638
3,5-dihydroxy-6-methyl-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 46901638) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 3,5-dihydroxy-6-methyl-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-dihydroxy-6-methyl-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 46901638 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 3,5-dihydroxy-6-methyl-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)=CCC1=C(O)C(C)(CC=C(C)C)C(=O)C(C(=O)C(C)C)=C1O |
| InChI | InChI=1S/C21H30O4/c1-12(2)8-9-15-18(23)16(17(22)14(5)6)20(25)21(7,19(15)24)11-10-13(3)4/h8,10,14,23-24H,9,11H2,1-7H3 |
| InChIKey | BNJVTTIFQVZJCK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|