C22H40O7Si — CID 46901649
ethyl 2-[(1S,3R,8S,10R,12S,13R)-6,6-ditert-butyl-13-hydroxy-13-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate (PubChem CID 46901649) has the molecular formula C22H40O7Si and a molecular weight of 444.64 g/mol. Its IUPAC name is ethyl 2-[(1S,3R,8S,10R,12S,13R)-6,6-ditert-butyl-13-hydroxy-13-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate.
| Compound Name | ethyl 2-[(1S,3R,8S,10R,12S,13R)-6,6-ditert-butyl-13-hydroxy-13-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate |
|---|---|
| PubChem CID | 46901649 |
| Molecular Formula | C22H40O7Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | ethyl 2-[(1S,3R,8S,10R,12S,13R)-6,6-ditert-butyl-13-hydroxy-13-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1O[C@@H]2C[C@@H]3O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]3O[C@H]2C[C@@]1(C)O |
| InChI | InChI=1S/C22H40O7Si/c1-9-25-19(23)11-18-22(8,24)12-16-14(28-18)10-15-17(27-16)13-26-30(29-15,20(2,3)4)21(5,6)7/h14-18,24H,9-13H2,1-8H3/t14-,15+,16+,17-,18+,22-/m1/s1 |
| InChIKey | WPNSLZBOVQOMFO-ZNGWZVJISA-N |
| XLogP | 3.46 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|