C21H15Cl2NO4S — CID 46901691
2-(2,6-dichlorophenyl)-3-hydroperoxy-4,5-diphenyl-3H-1,2-thiazole 1,1-dioxide (PubChem CID 46901691) has the molecular formula C21H15Cl2NO4S and a molecular weight of 448.33 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-3-hydroperoxy-4,5-diphenyl-3H-1,2-thiazole 1,1-dioxide.
| Compound Name | 2-(2,6-dichlorophenyl)-3-hydroperoxy-4,5-diphenyl-3H-1,2-thiazole 1,1-dioxide |
|---|---|
| PubChem CID | 46901691 |
| Molecular Formula | C21H15Cl2NO4S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-3-hydroperoxy-4,5-diphenyl-3H-1,2-thiazole 1,1-dioxide |
| SMILES | O=S1(=O)C(c2ccccc2)=C(c2ccccc2)C(OO)N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H15Cl2NO4S/c22-16-12-7-13-17(23)19(16)24-21(28-25)18(14-8-3-1-4-9-14)20(29(24,26)27)15-10-5-2-6-11-15/h1-13,21,25H |
| InChIKey | VUILURNEJQVMOC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|