About tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate
tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 46901716) has the molecular formula C22H30N6O4
and a molecular weight of 442.52 g/mol. Its IUPAC name is tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate |
| PubChem CID | 46901716 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)Nc1cc(-c2cc([N+](=O)[O-])cc(N3CCN(C(=O)OC(C)(C)C)CC3)n2)ccn1 |
| InChI | InChI=1S/C22H30N6O4/c1-15(2)24-19-12-16(6-7-23-19)18-13-17(28(30)31)14-20(25-18)26-8-10-27(11-9-26)21(29)32-22(3,4)5/h6-7,12-15H,8-11H2,1-5H3,(H,23,24) |
| InChIKey | APDMKSOLKFKSKF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate (CID 46901716) is tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate is CC(C)Nc1cc(-c2cc([N+](=O)[O-])cc(N3CCN(C(=O)OC(C)(C)C)CC3)n2)ccn1.
What is the InChIKey of tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate?
The InChIKey is APDMKSOLKFKSKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N6O4/c1-15(2)24-19-12-16(6-7-23-19)18-13-17(28(30)31)14-20(25-18)26-8-10-27(11-9-26)21(29)32-22(3,4)5/h6-7,12-15H,8-11H2,1-5H3,(H,23,24).
What are the key properties of tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate?
tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate has a molecular weight of 442.52 g/mol, XLogP of 3.93, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-nitro-6-[2-(propan-2-ylamino)-4-pyridinyl]-2-pyridinyl]piperazine-1-carboxylate is sourced from PubChem (CID 46901716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).