About N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine
N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine (PubChem CID 46901859) has the molecular formula C15H15N5
and a molecular weight of 265.32 g/mol. Its IUPAC name is N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine |
| PubChem CID | 46901859 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine |
| SMILES | NCCNc1nc(-c2ccncc2)cc2cnccc12 |
| InChI | InChI=1S/C15H15N5/c16-4-8-19-15-13-3-7-18-10-12(13)9-14(20-15)11-1-5-17-6-2-11/h1-3,5-7,9-10H,4,8,16H2,(H,19,20) |
| InChIKey | OBRQLJITIRIMLQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine?
The IUPAC name of N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine (CID 46901859) is N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine is NCCNc1nc(-c2ccncc2)cc2cnccc12.
What is the InChIKey of N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine?
The InChIKey is OBRQLJITIRIMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5/c16-4-8-19-15-13-3-7-18-10-12(13)9-14(20-15)11-1-5-17-6-2-11/h1-3,5-7,9-10H,4,8,16H2,(H,19,20).
What are the key properties of N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine?
N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine has a molecular weight of 265.32 g/mol, XLogP of 2.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-pyridin-4-yl-2,6-naphthyridin-1-yl)ethane-1,2-diamine is sourced from PubChem (CID 46901859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).