C25H29N3O3 — CID 46902335
(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(4-methoxyphenyl)-2-(methylamino)-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one (PubChem CID 46902335) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(4-methoxyphenyl)-2-(methylamino)-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one.
| Compound Name | (2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(4-methoxyphenyl)-2-(methylamino)-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 46902335 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(4-methoxyphenyl)-2-(methylamino)-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-4-one |
| SMILES | CN[C@H]1C[C@H]2c3[nH]c4ccc(-c5ccc(OC)cc5)cc4c3CCN2C(=O)[C@H]1[C@H](C)O |
| InChI | InChI=1S/C25H29N3O3/c1-14(29)23-21(26-2)13-22-24-18(10-11-28(22)25(23)30)19-12-16(6-9-20(19)27-24)15-4-7-17(31-3)8-5-15/h4-9,12,14,21-23,26-27,29H,10-11,13H2,1-3H3/t14-,21-,22-,23-/m0/s1 |
| InChIKey | OFUNYWKTZGLIMO-KHWSRKGVSA-N |
| XLogP | 3.26 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|