C33H38N4O4 — CID 46902344
1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(4-methoxyphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-(4-methoxyphenyl)-1-methylurea (PubChem CID 46902344) has the molecular formula C33H38N4O4 and a molecular weight of 554.69 g/mol. Its IUPAC name is 1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(4-methoxyphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-(4-methoxyphenyl)-1-methylurea.
| Compound Name | 1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(4-methoxyphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-(4-methoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 46902344 |
| Molecular Formula | C33H38N4O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(4-methoxyphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-(4-methoxyphenyl)-1-methylurea |
| SMILES | COc1ccc(NC(=O)N(C)[C@H]2C[C@H]3c4[nH]c5ccc(-c6ccc(OC)cc6)cc5c4CCN3C[C@H]2[C@H](C)O)cc1 |
| InChI | InChI=1S/C33H38N4O4/c1-20(38)28-19-37-16-15-26-27-17-22(21-5-10-24(40-3)11-6-21)7-14-29(27)35-32(26)31(37)18-30(28)36(2)33(39)34-23-8-12-25(41-4)13-9-23/h5-14,17,20,28,30-31,35,38H,15-16,18-19H2,1-4H3,(H,34,39)/t20-,28-,30-,31-/m0/s1 |
| InChIKey | BTWKERLVWJCTDC-ZQXQEFOJSA-N |
| XLogP | 5.68 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|