C32H42N4O2 — CID 46902350
1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(3-methylphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-cyclohexyl-1-methylurea (PubChem CID 46902350) has the molecular formula C32H42N4O2 and a molecular weight of 514.71 g/mol. Its IUPAC name is 1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(3-methylphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-cyclohexyl-1-methylurea.
| Compound Name | 1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(3-methylphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-cyclohexyl-1-methylurea |
|---|---|
| PubChem CID | 46902350 |
| Molecular Formula | C32H42N4O2 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | 1-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-9-(3-methylphenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-cyclohexyl-1-methylurea |
| SMILES | Cc1cccc(-c2ccc3[nH]c4c(c3c2)CCN2C[C@@H]([C@H](C)O)[C@@H](N(C)C(=O)NC3CCCCC3)C[C@@H]42)c1 |
| InChI | InChI=1S/C32H42N4O2/c1-20-8-7-9-22(16-20)23-12-13-28-26(17-23)25-14-15-36-19-27(21(2)37)29(18-30(36)31(25)34-28)35(3)32(38)33-24-10-5-4-6-11-24/h7-9,12-13,16-17,21,24,27,29-30,34,37H,4-6,10-11,14-15,18-19H2,1-3H3,(H,33,38)/t21-,27-,29-,30-/m0/s1 |
| InChIKey | XTBCIHUMQWTMOT-LUQUXWHUSA-N |
| XLogP | 5.79 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|