C21H22Cl2N2O2 — CID 46902400
1-[(3aR,6S,7aS)-6-[3-(3,5-dichlorophenyl)phenyl]-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 46902400) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is 1-[(3aR,6S,7aS)-6-[3-(3,5-dichlorophenyl)phenyl]-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[(3aR,6S,7aS)-6-[3-(3,5-dichlorophenyl)phenyl]-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 46902400 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-[(3aR,6S,7aS)-6-[3-(3,5-dichlorophenyl)phenyl]-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | CC(=O)N1C[C@H]2CON(C)[C@H]2C[C@H]1c1cccc(-c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C21H22Cl2N2O2/c1-13(26)25-11-17-12-27-24(2)20(17)10-21(25)15-5-3-4-14(6-15)16-7-18(22)9-19(23)8-16/h3-9,17,20-21H,10-12H2,1-2H3/t17-,20-,21-/m0/s1 |
| InChIKey | WTXZVSFIOSBAKZ-YYWHXJBOSA-N |
| XLogP | 4.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |