C18H23BrN2O2 — CID 46902465
1-[(3aR,6S,7aS)-6-(4-bromophenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]pent-4-en-1-one (PubChem CID 46902465) has the molecular formula C18H23BrN2O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 1-[(3aR,6S,7aS)-6-(4-bromophenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]pent-4-en-1-one.
| Compound Name | 1-[(3aR,6S,7aS)-6-(4-bromophenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 46902465 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-[(3aR,6S,7aS)-6-(4-bromophenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1C[C@H]2CON(C)[C@H]2C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H23BrN2O2/c1-3-4-5-18(22)21-11-14-12-23-20(2)16(14)10-17(21)13-6-8-15(19)9-7-13/h3,6-9,14,16-17H,1,4-5,10-12H2,2H3/t14-,16-,17-/m0/s1 |
| InChIKey | AYRWBDMFNYQJKT-XIRDDKMYSA-N |
| XLogP | 3.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|