C19H22N2O — CID 46902475
(3aR,6S,7aS)-1-methyl-6-(4-phenylphenyl)-3a,4,5,6,7,7a-hexahydro-3H-[1,2]oxazolo[4,3-c]pyridine (PubChem CID 46902475) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (3aR,6S,7aS)-1-methyl-6-(4-phenylphenyl)-3a,4,5,6,7,7a-hexahydro-3H-[1,2]oxazolo[4,3-c]pyridine.
| Compound Name | (3aR,6S,7aS)-1-methyl-6-(4-phenylphenyl)-3a,4,5,6,7,7a-hexahydro-3H-[1,2]oxazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 46902475 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (3aR,6S,7aS)-1-methyl-6-(4-phenylphenyl)-3a,4,5,6,7,7a-hexahydro-3H-[1,2]oxazolo[4,3-c]pyridine |
| SMILES | CN1OC[C@@H]2CN[C@H](c3ccc(-c4ccccc4)cc3)C[C@@H]21 |
| InChI | InChI=1S/C19H22N2O/c1-21-19-11-18(20-12-17(19)13-22-21)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-10,17-20H,11-13H2,1H3/t17-,18-,19-/m0/s1 |
| InChIKey | DJGJOHJWDUEHAF-FHWLQOOXSA-N |
| XLogP | 3.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |