C28H29N3O3 — CID 46902493
N-[(2S,3R,11bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-10-phenyl-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizin-2-yl]-N-methylpyridine-3-carboxamide (PubChem CID 46902493) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[(2S,3R,11bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-10-phenyl-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizin-2-yl]-N-methylpyridine-3-carboxamide.
| Compound Name | N-[(2S,3R,11bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-10-phenyl-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizin-2-yl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46902493 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[(2S,3R,11bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-10-phenyl-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizin-2-yl]-N-methylpyridine-3-carboxamide |
| SMILES | C[C@H](O)[C@@H]1C(=O)N2CCc3ccc(-c4ccccc4)cc3[C@@H]2C[C@@H]1N(C)C(=O)c1cccnc1 |
| InChI | InChI=1S/C28H29N3O3/c1-18(32)26-25(30(2)27(33)22-9-6-13-29-17-22)16-24-23-15-21(19-7-4-3-5-8-19)11-10-20(23)12-14-31(24)28(26)34/h3-11,13,15,17-18,24-26,32H,12,14,16H2,1-2H3/t18-,24-,25-,26-/m0/s1 |
| InChIKey | WVDGHUKOJXQDKJ-UZTPZCRESA-N |
| XLogP | 3.72 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |