C22H32N4O — CID 46902504
(3R,4R,6R)-4-(4-cyclopropyltriazol-1-yl)-1-hexyl-6-phenylpiperidin-3-ol (PubChem CID 46902504) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is (3R,4R,6R)-4-(4-cyclopropyltriazol-1-yl)-1-hexyl-6-phenylpiperidin-3-ol.
| Compound Name | (3R,4R,6R)-4-(4-cyclopropyltriazol-1-yl)-1-hexyl-6-phenylpiperidin-3-ol |
|---|---|
| PubChem CID | 46902504 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (3R,4R,6R)-4-(4-cyclopropyltriazol-1-yl)-1-hexyl-6-phenylpiperidin-3-ol |
| SMILES | CCCCCCN1C[C@@H](O)[C@H](n2cc(C3CC3)nn2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H32N4O/c1-2-3-4-8-13-25-16-22(27)21(14-20(25)18-9-6-5-7-10-18)26-15-19(23-24-26)17-11-12-17/h5-7,9-10,15,17,20-22,27H,2-4,8,11-14,16H2,1H3/t20-,21-,22-/m1/s1 |
| InChIKey | DSBYUZJTGKLKIL-YPAWHYETSA-N |
| XLogP | 4.08 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|