C26H33FN4O — CID 46902512
(3R,4R,6R)-4-[4-(4-fluorophenyl)triazol-1-yl]-1-hexyl-6-(4-methylphenyl)piperidin-3-ol (PubChem CID 46902512) has the molecular formula C26H33FN4O and a molecular weight of 436.58 g/mol. Its IUPAC name is (3R,4R,6R)-4-[4-(4-fluorophenyl)triazol-1-yl]-1-hexyl-6-(4-methylphenyl)piperidin-3-ol.
| Compound Name | (3R,4R,6R)-4-[4-(4-fluorophenyl)triazol-1-yl]-1-hexyl-6-(4-methylphenyl)piperidin-3-ol |
|---|---|
| PubChem CID | 46902512 |
| Molecular Formula | C26H33FN4O |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (3R,4R,6R)-4-[4-(4-fluorophenyl)triazol-1-yl]-1-hexyl-6-(4-methylphenyl)piperidin-3-ol |
| SMILES | CCCCCCN1C[C@@H](O)[C@H](n2cc(-c3ccc(F)cc3)nn2)C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C26H33FN4O/c1-3-4-5-6-15-30-18-26(32)25(16-24(30)21-9-7-19(2)8-10-21)31-17-23(28-29-31)20-11-13-22(27)14-12-20/h7-14,17,24-26,32H,3-6,15-16,18H2,1-2H3/t24-,25-,26-/m1/s1 |
| InChIKey | NLUWSXLDLFCXDE-TWJOJJKGSA-N |
| XLogP | 5.32 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|