C28H34N4O4 — CID 46902544
[1-[(3S,4S,6R)-1-hexanoyl-4-hydroxy-6-(4-methylphenyl)piperidin-3-yl]triazol-4-yl]methyl benzoate (PubChem CID 46902544) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is [1-[(3S,4S,6R)-1-hexanoyl-4-hydroxy-6-(4-methylphenyl)piperidin-3-yl]triazol-4-yl]methyl benzoate.
| Compound Name | [1-[(3S,4S,6R)-1-hexanoyl-4-hydroxy-6-(4-methylphenyl)piperidin-3-yl]triazol-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 46902544 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [1-[(3S,4S,6R)-1-hexanoyl-4-hydroxy-6-(4-methylphenyl)piperidin-3-yl]triazol-4-yl]methyl benzoate |
| SMILES | CCCCCC(=O)N1C[C@H](n2cc(COC(=O)c3ccccc3)nn2)[C@@H](O)C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C28H34N4O4/c1-3-4-6-11-27(34)31-18-25(26(33)16-24(31)21-14-12-20(2)13-15-21)32-17-23(29-30-32)19-36-28(35)22-9-7-5-8-10-22/h5,7-10,12-15,17,24-26,33H,3-4,6,11,16,18-19H2,1-2H3/t24-,25+,26+/m1/s1 |
| InChIKey | JEWFHEOZMNUBKU-ZNZIZOMTSA-N |
| XLogP | 4.40 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|