C23H34N4O — CID 46902580
(3S,4S,6R)-4-(4-cyclopropyltriazol-1-yl)-1-hexyl-6-(4-methylphenyl)piperidin-3-ol (PubChem CID 46902580) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is (3S,4S,6R)-4-(4-cyclopropyltriazol-1-yl)-1-hexyl-6-(4-methylphenyl)piperidin-3-ol.
| Compound Name | (3S,4S,6R)-4-(4-cyclopropyltriazol-1-yl)-1-hexyl-6-(4-methylphenyl)piperidin-3-ol |
|---|---|
| PubChem CID | 46902580 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (3S,4S,6R)-4-(4-cyclopropyltriazol-1-yl)-1-hexyl-6-(4-methylphenyl)piperidin-3-ol |
| SMILES | CCCCCCN1C[C@H](O)[C@@H](n2cc(C3CC3)nn2)C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H34N4O/c1-3-4-5-6-13-26-16-23(28)22(27-15-20(24-25-27)18-11-12-18)14-21(26)19-9-7-17(2)8-10-19/h7-10,15,18,21-23,28H,3-6,11-14,16H2,1-2H3/t21-,22+,23+/m1/s1 |
| InChIKey | SKSCWLKHHLXXKL-VJBWXMMDSA-N |
| XLogP | 4.39 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|